C15H37N3O5S — CID 173048694
N-butyl-2-methylprop-2-enamide;bis(N,N-dimethylmethanamine);methyl hydrogen sulfate (PubChem CID 173048694) has the molecular formula C15H37N3O5S and a molecular weight of 371.54 g/mol. Its IUPAC name is N-butyl-2-methylprop-2-enamide;bis(N,N-dimethylmethanamine);methyl hydrogen sulfate.
| Compound Name | N-butyl-2-methylprop-2-enamide;bis(N,N-dimethylmethanamine);methyl hydrogen sulfate |
|---|---|
| PubChem CID | 173048694 |
| Molecular Formula | C15H37N3O5S |
| Molecular Weight | 371.54 g/mol |
| Exact Mass | 371.25 |
| IUPAC Name | N-butyl-2-methylprop-2-enamide;bis(N,N-dimethylmethanamine);methyl hydrogen sulfate |
| SMILES | C=C(C)C(=O)NCCCC.CN(C)C.CN(C)C.COS(=O)(=O)O |
| InChI | InChI=1S/C8H15NO.2C3H9N.CH4O4S/c1-4-5-6-9-8(10)7(2)3;2*1-4(2)3;1-5-6(2,3)4/h2,4-6H2,1,3H3,(H,9,10);2*1-3H3;1H3,(H,2,3,4) |
| InChIKey | GSYLCNVEHSPXIU-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.54 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|