C19H38N2O — CID 88943735
N-[2-[dodecyl(methyl)amino]ethyl]-2-methylprop-2-enamide (PubChem CID 88943735) has the molecular formula C19H38N2O and a molecular weight of 310.53 g/mol. Its IUPAC name is N-[2-[dodecyl(methyl)amino]ethyl]-2-methylprop-2-enamide.
| Compound Name | N-[2-[dodecyl(methyl)amino]ethyl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 88943735 |
| Molecular Formula | C19H38N2O |
| Molecular Weight | 310.53 g/mol |
| Exact Mass | 310.30 |
| IUPAC Name | N-[2-[dodecyl(methyl)amino]ethyl]-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)NCCN(C)CCCCCCCCCCCC |
| InChI | InChI=1S/C19H38N2O/c1-5-6-7-8-9-10-11-12-13-14-16-21(4)17-15-20-19(22)18(2)3/h2,5-17H2,1,3-4H3,(H,20,22) |
| InChIKey | ULNFKRQZWASRFN-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.53 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|