C17H35N2O4S+ — CID 122622475
dimethyl-[8-(2-methylprop-2-enoylamino)octyl]-(3-sulfopropyl)azanium (PubChem CID 122622475) has the molecular formula C17H35N2O4S+ and a molecular weight of 363.54 g/mol. Its IUPAC name is dimethyl-[8-(2-methylprop-2-enoylamino)octyl]-(3-sulfopropyl)azanium.
| Compound Name | dimethyl-[8-(2-methylprop-2-enoylamino)octyl]-(3-sulfopropyl)azanium |
|---|---|
| PubChem CID | 122622475 |
| Molecular Formula | C17H35N2O4S+ |
| Molecular Weight | 363.54 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | dimethyl-[8-(2-methylprop-2-enoylamino)octyl]-(3-sulfopropyl)azanium |
| SMILES | C=C(C)C(=O)NCCCCCCCC[N+](C)(C)CCCS(=O)(=O)O |
| InChI | InChI=1S/C17H34N2O4S/c1-16(2)17(20)18-12-9-7-5-6-8-10-13-19(3,4)14-11-15-24(21,22)23/h1,5-15H2,2-4H3,(H-,18,20,21,22,23)/p+1 |
| InChIKey | CTICNWVRZHFAAR-UHFFFAOYSA-O |
| XLogP | 2.37 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.54 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|