C18H37N2O4S+ — CID 118143888
dimethyl-[10-(prop-2-enoylamino)decyl]-(3-sulfopropyl)azanium (PubChem CID 118143888) has the molecular formula C18H37N2O4S+ and a molecular weight of 377.57 g/mol. Its IUPAC name is dimethyl-[10-(prop-2-enoylamino)decyl]-(3-sulfopropyl)azanium.
| Compound Name | dimethyl-[10-(prop-2-enoylamino)decyl]-(3-sulfopropyl)azanium |
|---|---|
| PubChem CID | 118143888 |
| Molecular Formula | C18H37N2O4S+ |
| Molecular Weight | 377.57 g/mol |
| Exact Mass | 377.25 |
| IUPAC Name | dimethyl-[10-(prop-2-enoylamino)decyl]-(3-sulfopropyl)azanium |
| SMILES | C=CC(=O)NCCCCCCCCCC[N+](C)(C)CCCS(=O)(=O)O |
| InChI | InChI=1S/C18H36N2O4S/c1-4-18(21)19-14-11-9-7-5-6-8-10-12-15-20(2,3)16-13-17-25(22,23)24/h4H,1,5-17H2,2-3H3,(H-,19,21,22,23,24)/p+1 |
| InChIKey | ATCHKIDRDIDWPC-UHFFFAOYSA-O |
| XLogP | 2.76 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.57 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|