C20H42N4O6S — CID 141071800
bis(ethyl-dimethyl-[3-(prop-2-enoylamino)propyl]azanium);sulfate (PubChem CID 141071800) has the molecular formula C20H42N4O6S and a molecular weight of 466.65 g/mol. Its IUPAC name is bis(ethyl-dimethyl-[3-(prop-2-enoylamino)propyl]azanium);sulfate.
| Compound Name | bis(ethyl-dimethyl-[3-(prop-2-enoylamino)propyl]azanium);sulfate |
|---|---|
| PubChem CID | 141071800 |
| Molecular Formula | C20H42N4O6S |
| Molecular Weight | 466.65 g/mol |
| Exact Mass | 466.28 |
| IUPAC Name | bis(ethyl-dimethyl-[3-(prop-2-enoylamino)propyl]azanium);sulfate |
| SMILES | C=CC(=O)NCCC[N+](C)(C)CC.C=CC(=O)NCCC[N+](C)(C)CC.O=S(=O)([O-])[O-] |
| InChI | InChI=1S/2C10H20N2O.H2O4S/c2*1-5-10(13)11-8-7-9-12(3,4)6-2;1-5(2,3)4/h2*5H,1,6-9H2,2-4H3;(H2,1,2,3,4) |
| InChIKey | LHSIWRLVLWMOOM-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 138.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.65 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|