C10H22N2O4S — CID 139988400
dimethyl-[3-(prop-2-enoylamino)propyl]azanium;ethanesulfonate (PubChem CID 139988400) has the molecular formula C10H22N2O4S and a molecular weight of 266.36 g/mol. Its IUPAC name is dimethyl-[3-(prop-2-enoylamino)propyl]azanium;ethanesulfonate.
| Compound Name | dimethyl-[3-(prop-2-enoylamino)propyl]azanium;ethanesulfonate |
|---|---|
| PubChem CID | 139988400 |
| Molecular Formula | C10H22N2O4S |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | dimethyl-[3-(prop-2-enoylamino)propyl]azanium;ethanesulfonate |
| SMILES | C=CC(=O)NCCC[NH+](C)C.CCS(=O)(=O)[O-] |
| InChI | InChI=1S/C8H16N2O.C2H6O3S/c1-4-8(11)9-6-5-7-10(2)3;1-2-6(3,4)5/h4H,1,5-7H2,2-3H3,(H,9,11);2H2,1H3,(H,3,4,5) |
| InChIKey | BQJZWXWBNFULDQ-UHFFFAOYSA-N |
| XLogP | -1.63 |
| TPSA | 90.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|