About N-butylprop-2-enamide;hydrofluoride
N-butylprop-2-enamide;hydrofluoride (PubChem CID 174533496) has the molecular formula C7H14FNO
and a molecular weight of 147.19 g/mol. Its IUPAC name is N-butylprop-2-enamide;hydrofluoride.
Molecular Properties
| Compound Name | N-butylprop-2-enamide;hydrofluoride |
| PubChem CID | 174533496 |
| Molecular Formula | C7H14FNO |
| Molecular Weight | 147.19 g/mol |
| Exact Mass | 147.11 |
| IUPAC Name | N-butylprop-2-enamide;hydrofluoride |
| SMILES | C=CC(=O)NCCCC.F |
| InChI | InChI=1S/C7H13NO.FH/c1-3-5-6-8-7(9)4-2;/h4H,2-3,5-6H2,1H3,(H,8,9);1H |
| InChIKey | YMBCGAABJAUFRG-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.19 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-butylprop-2-enamide;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butylprop-2-enamide;hydrofluoride?
The IUPAC name of N-butylprop-2-enamide;hydrofluoride (CID 174533496) is N-butylprop-2-enamide;hydrofluoride.
What is the SMILES notation for N-butylprop-2-enamide;hydrofluoride?
The canonical SMILES for N-butylprop-2-enamide;hydrofluoride is C=CC(=O)NCCCC.F.
What is the InChIKey of N-butylprop-2-enamide;hydrofluoride?
The InChIKey is YMBCGAABJAUFRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO.FH/c1-3-5-6-8-7(9)4-2;/h4H,2-3,5-6H2,1H3,(H,8,9);1H.
What are the key properties of N-butylprop-2-enamide;hydrofluoride?
N-butylprop-2-enamide;hydrofluoride has a molecular weight of 147.19 g/mol, XLogP of 1.24, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-butylprop-2-enamide;hydrofluoride is sourced from PubChem (CID 174533496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).