About molecular hydrogen;N-propylprop-2-enamide
molecular hydrogen;N-propylprop-2-enamide (PubChem CID 153372503) has the molecular formula C6H13NO
and a molecular weight of 115.18 g/mol. Its IUPAC name is molecular hydrogen;N-propylprop-2-enamide.
Molecular Properties
| Compound Name | molecular hydrogen;N-propylprop-2-enamide |
| PubChem CID | 153372503 |
| Molecular Formula | C6H13NO |
| Molecular Weight | 115.18 g/mol |
| Exact Mass | 115.10 |
| IUPAC Name | molecular hydrogen;N-propylprop-2-enamide |
| SMILES | C=CC(=O)NCCC.[H][H] |
| InChI | InChI=1S/C6H11NO.H2/c1-3-5-7-6(8)4-2;/h4H,2-3,5H2,1H3,(H,7,8);1H |
| InChIKey | NQDUPIZWWAKECY-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.18 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze molecular hydrogen;N-propylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of molecular hydrogen;N-propylprop-2-enamide?
The IUPAC name of molecular hydrogen;N-propylprop-2-enamide (CID 153372503) is molecular hydrogen;N-propylprop-2-enamide.
What is the SMILES notation for molecular hydrogen;N-propylprop-2-enamide?
The canonical SMILES for molecular hydrogen;N-propylprop-2-enamide is C=CC(=O)NCCC.[H][H].
What is the InChIKey of molecular hydrogen;N-propylprop-2-enamide?
The InChIKey is NQDUPIZWWAKECY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO.H2/c1-3-5-7-6(8)4-2;/h4H,2-3,5H2,1H3,(H,7,8);1H.
What are the key properties of molecular hydrogen;N-propylprop-2-enamide?
molecular hydrogen;N-propylprop-2-enamide has a molecular weight of 115.18 g/mol, XLogP of 0.94, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for molecular hydrogen;N-propylprop-2-enamide is sourced from PubChem (CID 153372503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).