molecular hydrogen;N-propylprop-2-enamide

C6H13NO — CID 153372503

IUPACmolecular hydrogen;N-propylprop-2-enamide
SMILESC=CC(=O)NCCC.[H][H]
InChIInChI=1S/C6H11NO.H2/c1-3-5-7-6(8)4-2;/h4H,2-3,5H2,1H3,(H,7,8);1H
InChIKeyNQDUPIZWWAKECY-UHFFFAOYSA-N
MW115.18 g/mol
LogP0.94
Rot. Bonds3

About molecular hydrogen;N-propylprop-2-enamide

molecular hydrogen;N-propylprop-2-enamide (PubChem CID 153372503) has the molecular formula C6H13NO and a molecular weight of 115.18 g/mol. Its IUPAC name is molecular hydrogen;N-propylprop-2-enamide.

Molecular Properties

Compound Namemolecular hydrogen;N-propylprop-2-enamide
PubChem CID153372503
Molecular FormulaC6H13NO
Molecular Weight115.18 g/mol
Exact Mass115.10
IUPAC Namemolecular hydrogen;N-propylprop-2-enamide
SMILESC=CC(=O)NCCC.[H][H]
InChIInChI=1S/C6H11NO.H2/c1-3-5-7-6(8)4-2;/h4H,2-3,5H2,1H3,(H,7,8);1H
InChIKeyNQDUPIZWWAKECY-UHFFFAOYSA-N
XLogP0.94
TPSA29.10 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms8
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500115.18
LogP ≤ 50.94
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze molecular hydrogen;N-propylprop-2-enamide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of molecular hydrogen;N-propylprop-2-enamide?
The IUPAC name of molecular hydrogen;N-propylprop-2-enamide (CID 153372503) is molecular hydrogen;N-propylprop-2-enamide.
What is the SMILES notation for molecular hydrogen;N-propylprop-2-enamide?
The canonical SMILES for molecular hydrogen;N-propylprop-2-enamide is C=CC(=O)NCCC.[H][H].
What is the InChIKey of molecular hydrogen;N-propylprop-2-enamide?
The InChIKey is NQDUPIZWWAKECY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO.H2/c1-3-5-7-6(8)4-2;/h4H,2-3,5H2,1H3,(H,7,8);1H.
What are the key properties of molecular hydrogen;N-propylprop-2-enamide?
molecular hydrogen;N-propylprop-2-enamide has a molecular weight of 115.18 g/mol, XLogP of 0.94, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for molecular hydrogen;N-propylprop-2-enamide is sourced from PubChem (CID 153372503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).