About molecular hydrogen;N-(3-oxobutyl)prop-2-enamide;prop-1-ene
molecular hydrogen;N-(3-oxobutyl)prop-2-enamide;prop-1-ene (PubChem CID 143781918) has the molecular formula C10H19NO2
and a molecular weight of 185.27 g/mol. Its IUPAC name is molecular hydrogen;N-(3-oxobutyl)prop-2-enamide;prop-1-ene.
Molecular Properties
| Compound Name | molecular hydrogen;N-(3-oxobutyl)prop-2-enamide;prop-1-ene |
| PubChem CID | 143781918 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | molecular hydrogen;N-(3-oxobutyl)prop-2-enamide;prop-1-ene |
| SMILES | C=CC.C=CC(=O)NCCC(C)=O.[H][H] |
| InChI | InChI=1S/C7H11NO2.C3H6.H2/c1-3-7(10)8-5-4-6(2)9;1-3-2;/h3H,1,4-5H2,2H3,(H,8,10);3H,1H2,2H3;1H |
| InChIKey | LIEBUOSHSFRSFE-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze molecular hydrogen;N-(3-oxobutyl)prop-2-enamide;prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of molecular hydrogen;N-(3-oxobutyl)prop-2-enamide;prop-1-ene?
The IUPAC name of molecular hydrogen;N-(3-oxobutyl)prop-2-enamide;prop-1-ene (CID 143781918) is molecular hydrogen;N-(3-oxobutyl)prop-2-enamide;prop-1-ene.
What is the SMILES notation for molecular hydrogen;N-(3-oxobutyl)prop-2-enamide;prop-1-ene?
The canonical SMILES for molecular hydrogen;N-(3-oxobutyl)prop-2-enamide;prop-1-ene is C=CC.C=CC(=O)NCCC(C)=O.[H][H].
What is the InChIKey of molecular hydrogen;N-(3-oxobutyl)prop-2-enamide;prop-1-ene?
The InChIKey is LIEBUOSHSFRSFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO2.C3H6.H2/c1-3-7(10)8-5-4-6(2)9;1-3-2;/h3H,1,4-5H2,2H3,(H,8,10);3H,1H2,2H3;1H.
What are the key properties of molecular hydrogen;N-(3-oxobutyl)prop-2-enamide;prop-1-ene?
molecular hydrogen;N-(3-oxobutyl)prop-2-enamide;prop-1-ene has a molecular weight of 185.27 g/mol, XLogP of 1.71, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for molecular hydrogen;N-(3-oxobutyl)prop-2-enamide;prop-1-ene is sourced from PubChem (CID 143781918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).