C8H13N3O2 — CID 141139350
N-[2-[[(E)-ethylidenecarbamoyl]amino]ethyl]prop-2-enamide (PubChem CID 141139350) has the molecular formula C8H13N3O2 and a molecular weight of 183.21 g/mol. Its IUPAC name is N-[2-[[(E)-ethylidenecarbamoyl]amino]ethyl]prop-2-enamide.
| Compound Name | N-[2-[[(E)-ethylidenecarbamoyl]amino]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 141139350 |
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | N-[2-[[(E)-ethylidenecarbamoyl]amino]ethyl]prop-2-enamide |
| SMILES | C=CC(=O)NCCNC(=O)/N=C/C |
| InChI | InChI=1S/C8H13N3O2/c1-3-7(12)10-5-6-11-8(13)9-4-2/h3-4H,1,5-6H2,2H3,(H,10,12)(H,11,13)/b9-4+ |
| InChIKey | PNXLYVJCNLVGNR-RUDMXATFSA-N |
| XLogP | 0.09 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|