C9H14N2O3 — CID 141187712
1-(ethylidenecarbamoylamino)propan-2-yl prop-2-enoate (PubChem CID 141187712) has the molecular formula C9H14N2O3 and a molecular weight of 198.22 g/mol. Its IUPAC name is 1-(ethylidenecarbamoylamino)propan-2-yl prop-2-enoate.
| Compound Name | 1-(ethylidenecarbamoylamino)propan-2-yl prop-2-enoate |
|---|---|
| PubChem CID | 141187712 |
| Molecular Formula | C9H14N2O3 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | 1-(ethylidenecarbamoylamino)propan-2-yl prop-2-enoate |
| SMILES | C=CC(=O)OC(C)CNC(=O)N=CC |
| InChI | InChI=1S/C9H14N2O3/c1-4-8(12)14-7(3)6-11-9(13)10-5-2/h4-5,7H,1,6H2,2-3H3,(H,11,13) |
| InChIKey | XYXIHFFWNRSRFP-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|