C11H20O4 — CID 161351901
methane;2-prop-2-enoyloxypropyl prop-2-enoate (PubChem CID 161351901) has the molecular formula C11H20O4 and a molecular weight of 216.28 g/mol. Its IUPAC name is methane;2-prop-2-enoyloxypropyl prop-2-enoate.
| Compound Name | methane;2-prop-2-enoyloxypropyl prop-2-enoate |
|---|---|
| PubChem CID | 161351901 |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | methane;2-prop-2-enoyloxypropyl prop-2-enoate |
| SMILES | C.C.C=CC(=O)OCC(C)OC(=O)C=C |
| InChI | InChI=1S/C9H12O4.2CH4/c1-4-8(10)12-6-7(3)13-9(11)5-2;;/h4-5,7H,1-2,6H2,3H3;2*1H4 |
| InChIKey | VOAMWLZESFMJRC-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|