C10H14O6 — CID 134236430
4-oxo-4-[(2R)-2-prop-2-enoyloxypropoxy]butanoic acid (PubChem CID 134236430) has the molecular formula C10H14O6 and a molecular weight of 230.22 g/mol. Its IUPAC name is 4-oxo-4-[(2R)-2-prop-2-enoyloxypropoxy]butanoic acid.
| Compound Name | 4-oxo-4-[(2R)-2-prop-2-enoyloxypropoxy]butanoic acid |
|---|---|
| PubChem CID | 134236430 |
| Molecular Formula | C10H14O6 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 4-oxo-4-[(2R)-2-prop-2-enoyloxypropoxy]butanoic acid |
| SMILES | C=CC(=O)O[C@H](C)COC(=O)CCC(=O)O |
| InChI | InChI=1S/C10H14O6/c1-3-9(13)16-7(2)6-15-10(14)5-4-8(11)12/h3,7H,1,4-6H2,2H3,(H,11,12)/t7-/m1/s1 |
| InChIKey | IRBOOYBZWZHLGO-SSDOTTSWSA-N |
| XLogP | 0.51 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|