C17H18O7 — CID 134236400
4-O-(4-formylphenyl) 1-O-(2-prop-2-enoyloxypropyl) butanedioate (PubChem CID 134236400) has the molecular formula C17H18O7 and a molecular weight of 334.32 g/mol. Its IUPAC name is 4-O-(4-formylphenyl) 1-O-(2-prop-2-enoyloxypropyl) butanedioate.
| Compound Name | 4-O-(4-formylphenyl) 1-O-(2-prop-2-enoyloxypropyl) butanedioate |
|---|---|
| PubChem CID | 134236400 |
| Molecular Formula | C17H18O7 |
| Molecular Weight | 334.32 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 4-O-(4-formylphenyl) 1-O-(2-prop-2-enoyloxypropyl) butanedioate |
| SMILES | C=CC(=O)OC(C)COC(=O)CCC(=O)Oc1ccc(C=O)cc1 |
| InChI | InChI=1S/C17H18O7/c1-3-15(19)23-12(2)11-22-16(20)8-9-17(21)24-14-6-4-13(10-18)5-7-14/h3-7,10,12H,1,8-9,11H2,2H3 |
| InChIKey | XESHPCWNNOTQDB-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.32 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|