About (4-formylphenyl) 4-bromobutanoate
(4-formylphenyl) 4-bromobutanoate (PubChem CID 162787582) has the molecular formula C11H11BrO3
and a molecular weight of 271.11 g/mol. Its IUPAC name is (4-formylphenyl) 4-bromobutanoate.
Molecular Properties
| Compound Name | (4-formylphenyl) 4-bromobutanoate |
| PubChem CID | 162787582 |
| Molecular Formula | C11H11BrO3 |
| Molecular Weight | 271.11 g/mol |
| Exact Mass | 269.99 |
| IUPAC Name | (4-formylphenyl) 4-bromobutanoate |
| SMILES | O=Cc1ccc(OC(=O)CCCBr)cc1 |
| InChI | InChI=1S/C11H11BrO3/c12-7-1-2-11(14)15-10-5-3-9(8-13)4-6-10/h3-6,8H,1-2,7H2 |
| InChIKey | SSKMXVXAGQHUOD-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.11 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-formylphenyl) 4-bromobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-formylphenyl) 4-bromobutanoate?
The IUPAC name of (4-formylphenyl) 4-bromobutanoate (CID 162787582) is (4-formylphenyl) 4-bromobutanoate.
What is the SMILES notation for (4-formylphenyl) 4-bromobutanoate?
The canonical SMILES for (4-formylphenyl) 4-bromobutanoate is O=Cc1ccc(OC(=O)CCCBr)cc1.
What is the InChIKey of (4-formylphenyl) 4-bromobutanoate?
The InChIKey is SSKMXVXAGQHUOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11BrO3/c12-7-1-2-11(14)15-10-5-3-9(8-13)4-6-10/h3-6,8H,1-2,7H2.
What are the key properties of (4-formylphenyl) 4-bromobutanoate?
(4-formylphenyl) 4-bromobutanoate has a molecular weight of 271.11 g/mol, XLogP of 2.58, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-formylphenyl) 4-bromobutanoate is sourced from PubChem (CID 162787582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).