About 4-(4-bromobutoxy)benzaldehyde;4-hydroxybenzaldehyde
4-(4-bromobutoxy)benzaldehyde;4-hydroxybenzaldehyde (PubChem CID 162220767) has the molecular formula C18H19BrO4
and a molecular weight of 379.25 g/mol. Its IUPAC name is 4-(4-bromobutoxy)benzaldehyde;4-hydroxybenzaldehyde.
Molecular Properties
| Compound Name | 4-(4-bromobutoxy)benzaldehyde;4-hydroxybenzaldehyde |
| PubChem CID | 162220767 |
| Molecular Formula | C18H19BrO4 |
| Molecular Weight | 379.25 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | 4-(4-bromobutoxy)benzaldehyde;4-hydroxybenzaldehyde |
| SMILES | O=Cc1ccc(O)cc1.O=Cc1ccc(OCCCCBr)cc1 |
| InChI | InChI=1S/C11H13BrO2.C7H6O2/c12-7-1-2-8-14-11-5-3-10(9-13)4-6-11;8-5-6-1-3-7(9)4-2-6/h3-6,9H,1-2,7-8H2;1-5,9H |
| InChIKey | ZUBYCOVXOZOICN-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.25 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-bromobutoxy)benzaldehyde;4-hydroxybenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-bromobutoxy)benzaldehyde;4-hydroxybenzaldehyde?
The IUPAC name of 4-(4-bromobutoxy)benzaldehyde;4-hydroxybenzaldehyde (CID 162220767) is 4-(4-bromobutoxy)benzaldehyde;4-hydroxybenzaldehyde.
What is the SMILES notation for 4-(4-bromobutoxy)benzaldehyde;4-hydroxybenzaldehyde?
The canonical SMILES for 4-(4-bromobutoxy)benzaldehyde;4-hydroxybenzaldehyde is O=Cc1ccc(O)cc1.O=Cc1ccc(OCCCCBr)cc1.
What is the InChIKey of 4-(4-bromobutoxy)benzaldehyde;4-hydroxybenzaldehyde?
The InChIKey is ZUBYCOVXOZOICN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13BrO2.C7H6O2/c12-7-1-2-8-14-11-5-3-10(9-13)4-6-11;8-5-6-1-3-7(9)4-2-6/h3-6,9H,1-2,7-8H2;1-5,9H.
What are the key properties of 4-(4-bromobutoxy)benzaldehyde;4-hydroxybenzaldehyde?
4-(4-bromobutoxy)benzaldehyde;4-hydroxybenzaldehyde has a molecular weight of 379.25 g/mol, XLogP of 4.26, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-bromobutoxy)benzaldehyde;4-hydroxybenzaldehyde is sourced from PubChem (CID 162220767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).