C40H45BrO10 — CID 158921526
(4-ethoxyphenyl)methyl 4-bromobutanoate;(4-ethoxyphenyl)methyl 4-(4-formylphenoxy)butanoate;4-hydroxybenzaldehyde (PubChem CID 158921526) has the molecular formula C40H45BrO10 and a molecular weight of 765.69 g/mol. Its IUPAC name is (4-ethoxyphenyl)methyl 4-bromobutanoate;(4-ethoxyphenyl)methyl 4-(4-formylphenoxy)butanoate;4-hydroxybenzaldehyde.
| Compound Name | (4-ethoxyphenyl)methyl 4-bromobutanoate;(4-ethoxyphenyl)methyl 4-(4-formylphenoxy)butanoate;4-hydroxybenzaldehyde |
|---|---|
| PubChem CID | 158921526 |
| Molecular Formula | C40H45BrO10 |
| Molecular Weight | 765.69 g/mol |
| Exact Mass | 764.22 |
| IUPAC Name | (4-ethoxyphenyl)methyl 4-bromobutanoate;(4-ethoxyphenyl)methyl 4-(4-formylphenoxy)butanoate;4-hydroxybenzaldehyde |
| SMILES | CCOc1ccc(COC(=O)CCCBr)cc1.CCOc1ccc(COC(=O)CCCOc2ccc(C=O)cc2)cc1.O=Cc1ccc(O)cc1 |
| InChI | InChI=1S/C20H22O5.C13H17BrO3.C7H6O2/c1-2-23-18-11-7-17(8-12-18)15-25-20(22)4-3-13-24-19-9-5-16(14-21)6-10-19;1-2-16-12-7-5-11(6-8-12)10-17-13(15)4-3-9-14;8-5-6-1-3-7(9)4-2-6/h5-12,14H,2-4,13,15H2,1H3;5-8H,2-4,9-10H2,1H3;1-5,9H |
| InChIKey | JHWXRWRGOBJFAA-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.69 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|