About (4-formylphenyl) octanoate;4-hydroxybenzaldehyde
(4-formylphenyl) octanoate;4-hydroxybenzaldehyde (PubChem CID 161257704) has the molecular formula C22H26O5
and a molecular weight of 370.45 g/mol. Its IUPAC name is (4-formylphenyl) octanoate;4-hydroxybenzaldehyde.
Molecular Properties
| Compound Name | (4-formylphenyl) octanoate;4-hydroxybenzaldehyde |
| PubChem CID | 161257704 |
| Molecular Formula | C22H26O5 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | (4-formylphenyl) octanoate;4-hydroxybenzaldehyde |
| SMILES | CCCCCCCC(=O)Oc1ccc(C=O)cc1.O=Cc1ccc(O)cc1 |
| InChI | InChI=1S/C15H20O3.C7H6O2/c1-2-3-4-5-6-7-15(17)18-14-10-8-13(12-16)9-11-14;8-5-6-1-3-7(9)4-2-6/h8-12H,2-7H2,1H3;1-5,9H |
| InChIKey | VCDKTBOJVDRNII-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-formylphenyl) octanoate;4-hydroxybenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-formylphenyl) octanoate;4-hydroxybenzaldehyde?
The IUPAC name of (4-formylphenyl) octanoate;4-hydroxybenzaldehyde (CID 161257704) is (4-formylphenyl) octanoate;4-hydroxybenzaldehyde.
What is the SMILES notation for (4-formylphenyl) octanoate;4-hydroxybenzaldehyde?
The canonical SMILES for (4-formylphenyl) octanoate;4-hydroxybenzaldehyde is CCCCCCCC(=O)Oc1ccc(C=O)cc1.O=Cc1ccc(O)cc1.
What is the InChIKey of (4-formylphenyl) octanoate;4-hydroxybenzaldehyde?
The InChIKey is VCDKTBOJVDRNII-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O3.C7H6O2/c1-2-3-4-5-6-7-15(17)18-14-10-8-13(12-16)9-11-14;8-5-6-1-3-7(9)4-2-6/h8-12H,2-7H2,1H3;1-5,9H.
What are the key properties of (4-formylphenyl) octanoate;4-hydroxybenzaldehyde?
(4-formylphenyl) octanoate;4-hydroxybenzaldehyde has a molecular weight of 370.45 g/mol, XLogP of 4.97, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-formylphenyl) octanoate;4-hydroxybenzaldehyde is sourced from PubChem (CID 161257704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).