About (4-formylphenyl) 2-cyanoacetate
(4-formylphenyl) 2-cyanoacetate (PubChem CID 71409107) has the molecular formula C10H7NO3
and a molecular weight of 189.17 g/mol. Its IUPAC name is (4-formylphenyl) 2-cyanoacetate.
Molecular Properties
| Compound Name | (4-formylphenyl) 2-cyanoacetate |
| PubChem CID | 71409107 |
| Molecular Formula | C10H7NO3 |
| Molecular Weight | 189.17 g/mol |
| Exact Mass | 189.04 |
| IUPAC Name | (4-formylphenyl) 2-cyanoacetate |
| SMILES | N#CCC(=O)Oc1ccc(C=O)cc1 |
| InChI | InChI=1S/C10H7NO3/c11-6-5-10(13)14-9-3-1-8(7-12)2-4-9/h1-4,7H,5H2 |
| InChIKey | BNPJJFPONHHMJU-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.17 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-formylphenyl) 2-cyanoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-formylphenyl) 2-cyanoacetate?
The IUPAC name of (4-formylphenyl) 2-cyanoacetate (CID 71409107) is (4-formylphenyl) 2-cyanoacetate.
What is the SMILES notation for (4-formylphenyl) 2-cyanoacetate?
The canonical SMILES for (4-formylphenyl) 2-cyanoacetate is N#CCC(=O)Oc1ccc(C=O)cc1.
What is the InChIKey of (4-formylphenyl) 2-cyanoacetate?
The InChIKey is BNPJJFPONHHMJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7NO3/c11-6-5-10(13)14-9-3-1-8(7-12)2-4-9/h1-4,7H,5H2.
What are the key properties of (4-formylphenyl) 2-cyanoacetate?
(4-formylphenyl) 2-cyanoacetate has a molecular weight of 189.17 g/mol, XLogP of 1.32, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-formylphenyl) 2-cyanoacetate is sourced from PubChem (CID 71409107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).