C9H5F3O2 — CID 22227324
4-(1,2,2-trifluoroethenoxy)benzaldehyde (PubChem CID 22227324) has the molecular formula C9H5F3O2 and a molecular weight of 202.13 g/mol. Its IUPAC name is 4-(1,2,2-trifluoroethenoxy)benzaldehyde.
| Compound Name | 4-(1,2,2-trifluoroethenoxy)benzaldehyde |
|---|---|
| PubChem CID | 22227324 |
| Molecular Formula | C9H5F3O2 |
| Molecular Weight | 202.13 g/mol |
| Exact Mass | 202.02 |
| IUPAC Name | 4-(1,2,2-trifluoroethenoxy)benzaldehyde |
| SMILES | O=Cc1ccc(OC(F)=C(F)F)cc1 |
| InChI | InChI=1S/C9H5F3O2/c10-8(11)9(12)14-7-3-1-6(5-13)2-4-7/h1-5H |
| InChIKey | DFPRRKSVQKNEFT-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.13 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|