C20H15F3O3 — CID 54520299
1-(4-methoxyphenyl)-5-[4-(1,2,2-trifluoroethenoxy)phenyl]penta-1,4-dien-3-one (PubChem CID 54520299) has the molecular formula C20H15F3O3 and a molecular weight of 360.33 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-5-[4-(1,2,2-trifluoroethenoxy)phenyl]penta-1,4-dien-3-one.
| Compound Name | 1-(4-methoxyphenyl)-5-[4-(1,2,2-trifluoroethenoxy)phenyl]penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 54520299 |
| Molecular Formula | C20H15F3O3 |
| Molecular Weight | 360.33 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | 1-(4-methoxyphenyl)-5-[4-(1,2,2-trifluoroethenoxy)phenyl]penta-1,4-dien-3-one |
| SMILES | COc1ccc(C=CC(=O)C=Cc2ccc(OC(F)=C(F)F)cc2)cc1 |
| InChI | InChI=1S/C20H15F3O3/c1-25-17-10-4-14(5-11-17)2-8-16(24)9-3-15-6-12-18(13-7-15)26-20(23)19(21)22/h2-13H,1H3 |
| InChIKey | YPIHSCZFIZEBHM-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.33 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|