C19H13F3O3 — CID 57234047
1-(4-acetylphenyl)-3-[4-(1,2,2-trifluoroethenoxy)phenyl]prop-2-en-1-one (PubChem CID 57234047) has the molecular formula C19H13F3O3 and a molecular weight of 346.30 g/mol. Its IUPAC name is 1-(4-acetylphenyl)-3-[4-(1,2,2-trifluoroethenoxy)phenyl]prop-2-en-1-one.
| Compound Name | 1-(4-acetylphenyl)-3-[4-(1,2,2-trifluoroethenoxy)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 57234047 |
| Molecular Formula | C19H13F3O3 |
| Molecular Weight | 346.30 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 1-(4-acetylphenyl)-3-[4-(1,2,2-trifluoroethenoxy)phenyl]prop-2-en-1-one |
| SMILES | CC(=O)c1ccc(C(=O)C=Cc2ccc(OC(F)=C(F)F)cc2)cc1 |
| InChI | InChI=1S/C19H13F3O3/c1-12(23)14-5-7-15(8-6-14)17(24)11-4-13-2-9-16(10-3-13)25-19(22)18(20)21/h2-11H,1H3 |
| InChIKey | AQXBXGATKKXJPO-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.30 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|