C17H12F3NO2 — CID 57066483
1-(4-aminophenyl)-3-[4-(1,2,2-trifluoroethenoxy)phenyl]prop-2-en-1-one (PubChem CID 57066483) has the molecular formula C17H12F3NO2 and a molecular weight of 319.28 g/mol. Its IUPAC name is 1-(4-aminophenyl)-3-[4-(1,2,2-trifluoroethenoxy)phenyl]prop-2-en-1-one.
| Compound Name | 1-(4-aminophenyl)-3-[4-(1,2,2-trifluoroethenoxy)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 57066483 |
| Molecular Formula | C17H12F3NO2 |
| Molecular Weight | 319.28 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 1-(4-aminophenyl)-3-[4-(1,2,2-trifluoroethenoxy)phenyl]prop-2-en-1-one |
| SMILES | Nc1ccc(C(=O)C=Cc2ccc(OC(F)=C(F)F)cc2)cc1 |
| InChI | InChI=1S/C17H12F3NO2/c18-16(19)17(20)23-14-8-1-11(2-9-14)3-10-15(22)12-4-6-13(21)7-5-12/h1-10H,21H2 |
| InChIKey | NDMHABQGNKXTPM-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.28 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|