C20H13F3O4 — CID 54190482
4-[3-oxo-5-[4-(1,2,2-trifluoroethenoxy)phenyl]penta-1,4-dienyl]benzoic acid (PubChem CID 54190482) has the molecular formula C20H13F3O4 and a molecular weight of 374.31 g/mol. Its IUPAC name is 4-[3-oxo-5-[4-(1,2,2-trifluoroethenoxy)phenyl]penta-1,4-dienyl]benzoic acid.
| Compound Name | 4-[3-oxo-5-[4-(1,2,2-trifluoroethenoxy)phenyl]penta-1,4-dienyl]benzoic acid |
|---|---|
| PubChem CID | 54190482 |
| Molecular Formula | C20H13F3O4 |
| Molecular Weight | 374.31 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | 4-[3-oxo-5-[4-(1,2,2-trifluoroethenoxy)phenyl]penta-1,4-dienyl]benzoic acid |
| SMILES | O=C(C=Cc1ccc(OC(F)=C(F)F)cc1)C=Cc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C20H13F3O4/c21-18(22)19(23)27-17-11-5-14(6-12-17)4-10-16(24)9-3-13-1-7-15(8-2-13)20(25)26/h1-12H,(H,25,26) |
| InChIKey | PIDZHHPZTXPWLN-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.31 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|