C36H23F9O3 — CID 54067100
1-[4-[1,1-bis[4-(1,2,2-trifluoroethenoxy)phenyl]ethyl]phenyl]-5-[4-(trifluoromethyl)phenyl]penta-1,4-dien-3-one (PubChem CID 54067100) has the molecular formula C36H23F9O3 and a molecular weight of 674.56 g/mol. Its IUPAC name is 1-[4-[1,1-bis[4-(1,2,2-trifluoroethenoxy)phenyl]ethyl]phenyl]-5-[4-(trifluoromethyl)phenyl]penta-1,4-dien-3-one.
| Compound Name | 1-[4-[1,1-bis[4-(1,2,2-trifluoroethenoxy)phenyl]ethyl]phenyl]-5-[4-(trifluoromethyl)phenyl]penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 54067100 |
| Molecular Formula | C36H23F9O3 |
| Molecular Weight | 674.56 g/mol |
| Exact Mass | 674.15 |
| IUPAC Name | 1-[4-[1,1-bis[4-(1,2,2-trifluoroethenoxy)phenyl]ethyl]phenyl]-5-[4-(trifluoromethyl)phenyl]penta-1,4-dien-3-one |
| SMILES | CC(c1ccc(C=CC(=O)C=Cc2ccc(C(F)(F)F)cc2)cc1)(c1ccc(OC(F)=C(F)F)cc1)c1ccc(OC(F)=C(F)F)cc1 |
| InChI | InChI=1S/C36H23F9O3/c1-35(25-12-18-29(19-13-25)47-33(41)31(37)38,26-14-20-30(21-15-26)48-34(42)32(39)40)24-8-2-22(3-9-24)6-16-28(46)17-7-23-4-10-27(11-5-23)36(43,44)45/h2-21H,1H3 |
| InChIKey | MDTKPPCOIAWMIB-UHFFFAOYSA-N |
| XLogP | 11.18 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.56 |
| LogP ≤ 5 | 11.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|