C37H26F6O5 — CID 18990506
2-[4-[(1E,4E)-5-[4-[1,1-bis[4-(1,2,2-trifluoroethenoxy)phenyl]ethyl]phenyl]-3-oxopenta-1,4-dienyl]phenyl]acetic acid (PubChem CID 18990506) has the molecular formula C37H26F6O5 and a molecular weight of 664.60 g/mol. Its IUPAC name is 2-[4-[(1E,4E)-5-[4-[1,1-bis[4-(1,2,2-trifluoroethenoxy)phenyl]ethyl]phenyl]-3-oxopenta-1,4-dienyl]phenyl]acetic acid.
| Compound Name | 2-[4-[(1E,4E)-5-[4-[1,1-bis[4-(1,2,2-trifluoroethenoxy)phenyl]ethyl]phenyl]-3-oxopenta-1,4-dienyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 18990506 |
| Molecular Formula | C37H26F6O5 |
| Molecular Weight | 664.60 g/mol |
| Exact Mass | 664.17 |
| IUPAC Name | 2-[4-[(1E,4E)-5-[4-[1,1-bis[4-(1,2,2-trifluoroethenoxy)phenyl]ethyl]phenyl]-3-oxopenta-1,4-dienyl]phenyl]acetic acid |
| SMILES | CC(c1ccc(/C=C/C(=O)/C=C/c2ccc(CC(=O)O)cc2)cc1)(c1ccc(OC(F)=C(F)F)cc1)c1ccc(OC(F)=C(F)F)cc1 |
| InChI | InChI=1S/C37H26F6O5/c1-37(27-12-18-30(19-13-27)47-35(42)33(38)39,28-14-20-31(21-15-28)48-36(43)34(40)41)26-10-6-24(7-11-26)9-17-29(44)16-8-23-2-4-25(5-3-23)22-32(45)46/h2-21H,22H2,1H3,(H,45,46)/b16-8+,17-9+ |
| InChIKey | LRDKRYUMRBQUFF-GONBZBRSSA-N |
| XLogP | 9.79 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.60 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|