C19H22O3 — CID 45398570
2-[4-[(4-tert-butylphenyl)methoxy]phenyl]acetic acid (PubChem CID 45398570) has the molecular formula C19H22O3 and a molecular weight of 298.38 g/mol. Its IUPAC name is 2-[4-[(4-tert-butylphenyl)methoxy]phenyl]acetic acid.
| Compound Name | 2-[4-[(4-tert-butylphenyl)methoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 45398570 |
| Molecular Formula | C19H22O3 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | 2-[4-[(4-tert-butylphenyl)methoxy]phenyl]acetic acid |
| SMILES | CC(C)(C)c1ccc(COc2ccc(CC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C19H22O3/c1-19(2,3)16-8-4-15(5-9-16)13-22-17-10-6-14(7-11-17)12-18(20)21/h4-11H,12-13H2,1-3H3,(H,20,21) |
| InChIKey | GXZIPEJETKWEJT-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |