C23H24O3S — CID 2948852
1-(benzenesulfonyl)-4-[(4-tert-butylphenoxy)methyl]benzene (PubChem CID 2948852) has the molecular formula C23H24O3S and a molecular weight of 380.51 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-4-[(4-tert-butylphenoxy)methyl]benzene.
| Compound Name | 1-(benzenesulfonyl)-4-[(4-tert-butylphenoxy)methyl]benzene |
|---|---|
| PubChem CID | 2948852 |
| Molecular Formula | C23H24O3S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | 1-(benzenesulfonyl)-4-[(4-tert-butylphenoxy)methyl]benzene |
| SMILES | CC(C)(C)c1ccc(OCc2ccc(S(=O)(=O)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C23H24O3S/c1-23(2,3)19-11-13-20(14-12-19)26-17-18-9-15-22(16-10-18)27(24,25)21-7-5-4-6-8-21/h4-16H,17H2,1-3H3 |
| InChIKey | DMEJYYCMXMDWKY-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |