C46H38O8S2 — CID 139826967
1,3-bis[[4-(4-phenylmethoxyphenyl)sulfonylphenoxy]methyl]benzene (PubChem CID 139826967) has the molecular formula C46H38O8S2 and a molecular weight of 782.94 g/mol. Its IUPAC name is 1,3-bis[[4-(4-phenylmethoxyphenyl)sulfonylphenoxy]methyl]benzene.
| Compound Name | 1,3-bis[[4-(4-phenylmethoxyphenyl)sulfonylphenoxy]methyl]benzene |
|---|---|
| PubChem CID | 139826967 |
| Molecular Formula | C46H38O8S2 |
| Molecular Weight | 782.94 g/mol |
| Exact Mass | 782.20 |
| IUPAC Name | 1,3-bis[[4-(4-phenylmethoxyphenyl)sulfonylphenoxy]methyl]benzene |
| SMILES | O=S(=O)(c1ccc(OCc2ccccc2)cc1)c1ccc(OCc2cccc(COc3ccc(S(=O)(=O)c4ccc(OCc5ccccc5)cc4)cc3)c2)cc1 |
| InChI | InChI=1S/C46H38O8S2/c47-55(48,43-22-14-39(15-23-43)51-31-35-8-3-1-4-9-35)45-26-18-41(19-27-45)53-33-37-12-7-13-38(30-37)34-54-42-20-28-46(29-21-42)56(49,50)44-24-16-40(17-25-44)52-32-36-10-5-2-6-11-36/h1-30H,31-34H2 |
| InChIKey | AHWRBFYBRMGISD-UHFFFAOYSA-N |
| XLogP | 9.67 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.94 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |