About phenoxymethylbenzene;sulfuric acid
phenoxymethylbenzene;sulfuric acid (PubChem CID 68982967) has the molecular formula C13H14O5S
and a molecular weight of 282.32 g/mol. Its IUPAC name is phenoxymethylbenzene;sulfuric acid.
Molecular Properties
| Compound Name | phenoxymethylbenzene;sulfuric acid |
| PubChem CID | 68982967 |
| Molecular Formula | C13H14O5S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | phenoxymethylbenzene;sulfuric acid |
| SMILES | O=S(=O)(O)O.c1ccc(COc2ccccc2)cc1 |
| InChI | InChI=1S/C13H12O.H2O4S/c1-3-7-12(8-4-1)11-14-13-9-5-2-6-10-13;1-5(2,3)4/h1-10H,11H2;(H2,1,2,3,4) |
| InChIKey | KEOXNKSLFUFORO-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze phenoxymethylbenzene;sulfuric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenoxymethylbenzene;sulfuric acid?
The IUPAC name of phenoxymethylbenzene;sulfuric acid (CID 68982967) is phenoxymethylbenzene;sulfuric acid.
What is the SMILES notation for phenoxymethylbenzene;sulfuric acid?
The canonical SMILES for phenoxymethylbenzene;sulfuric acid is O=S(=O)(O)O.c1ccc(COc2ccccc2)cc1.
What is the InChIKey of phenoxymethylbenzene;sulfuric acid?
The InChIKey is KEOXNKSLFUFORO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12O.H2O4S/c1-3-7-12(8-4-1)11-14-13-9-5-2-6-10-13;1-5(2,3)4/h1-10H,11H2;(H2,1,2,3,4).
What are the key properties of phenoxymethylbenzene;sulfuric acid?
phenoxymethylbenzene;sulfuric acid has a molecular weight of 282.32 g/mol, XLogP of 2.61, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phenoxymethylbenzene;sulfuric acid is sourced from PubChem (CID 68982967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).