C21H20O6S — CID 102022862
[3,5-bis(phenylmethoxy)phenyl]methyl hydrogen sulfate (PubChem CID 102022862) has the molecular formula C21H20O6S and a molecular weight of 400.45 g/mol. Its IUPAC name is [3,5-bis(phenylmethoxy)phenyl]methyl hydrogen sulfate.
| Compound Name | [3,5-bis(phenylmethoxy)phenyl]methyl hydrogen sulfate |
|---|---|
| PubChem CID | 102022862 |
| Molecular Formula | C21H20O6S |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | [3,5-bis(phenylmethoxy)phenyl]methyl hydrogen sulfate |
| SMILES | O=S(=O)(O)OCc1cc(OCc2ccccc2)cc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C21H20O6S/c22-28(23,24)27-16-19-11-20(25-14-17-7-3-1-4-8-17)13-21(12-19)26-15-18-9-5-2-6-10-18/h1-13H,14-16H2,(H,22,23,24) |
| InChIKey | BCXMKMOEFWUGPV-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|