C19H16O4S — CID 14178379
2-(4-phenylmethoxyphenyl)sulfonylphenol (PubChem CID 14178379) has the molecular formula C19H16O4S and a molecular weight of 340.40 g/mol. Its IUPAC name is 2-(4-phenylmethoxyphenyl)sulfonylphenol.
| Compound Name | 2-(4-phenylmethoxyphenyl)sulfonylphenol |
|---|---|
| PubChem CID | 14178379 |
| Molecular Formula | C19H16O4S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | 2-(4-phenylmethoxyphenyl)sulfonylphenol |
| SMILES | O=S(=O)(c1ccc(OCc2ccccc2)cc1)c1ccccc1O |
| InChI | InChI=1S/C19H16O4S/c20-18-8-4-5-9-19(18)24(21,22)17-12-10-16(11-13-17)23-14-15-6-2-1-3-7-15/h1-13,20H,14H2 |
| InChIKey | OAHRHEHKTRXORG-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |