C31H24O8S2 — CID 67162495
2-[4-[4-[[2-(4-hydroxyphenyl)sulfonylphenoxy]methyl]phenoxy]phenyl]sulfonylphenol (PubChem CID 67162495) has the molecular formula C31H24O8S2 and a molecular weight of 588.66 g/mol. Its IUPAC name is 2-[4-[4-[[2-(4-hydroxyphenyl)sulfonylphenoxy]methyl]phenoxy]phenyl]sulfonylphenol.
| Compound Name | 2-[4-[4-[[2-(4-hydroxyphenyl)sulfonylphenoxy]methyl]phenoxy]phenyl]sulfonylphenol |
|---|---|
| PubChem CID | 67162495 |
| Molecular Formula | C31H24O8S2 |
| Molecular Weight | 588.66 g/mol |
| Exact Mass | 588.09 |
| IUPAC Name | 2-[4-[4-[[2-(4-hydroxyphenyl)sulfonylphenoxy]methyl]phenoxy]phenyl]sulfonylphenol |
| SMILES | O=S(=O)(c1ccc(Oc2ccc(COc3ccccc3S(=O)(=O)c3ccc(O)cc3)cc2)cc1)c1ccccc1O |
| InChI | InChI=1S/C31H24O8S2/c32-23-11-17-26(18-12-23)41(36,37)31-8-4-2-6-29(31)38-21-22-9-13-24(14-10-22)39-25-15-19-27(20-16-25)40(34,35)30-7-3-1-5-28(30)33/h1-20,32-33H,21H2 |
| InChIKey | ARHQVCQTZGKJHK-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.66 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |