C17H20O4S — CID 101144520
4-(2-pentoxyphenyl)sulfonylphenol (PubChem CID 101144520) has the molecular formula C17H20O4S and a molecular weight of 320.41 g/mol. Its IUPAC name is 4-(2-pentoxyphenyl)sulfonylphenol.
| Compound Name | 4-(2-pentoxyphenyl)sulfonylphenol |
|---|---|
| PubChem CID | 101144520 |
| Molecular Formula | C17H20O4S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | 4-(2-pentoxyphenyl)sulfonylphenol |
| SMILES | CCCCCOc1ccccc1S(=O)(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C17H20O4S/c1-2-3-6-13-21-16-7-4-5-8-17(16)22(19,20)15-11-9-14(18)10-12-15/h4-5,7-12,18H,2-3,6,13H2,1H3 |
| InChIKey | YVGYITQIYUUIAB-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|