About 2-pentoxybenzenesulfonyl chloride
2-pentoxybenzenesulfonyl chloride (PubChem CID 87516954) has the molecular formula C11H15ClO3S
and a molecular weight of 262.76 g/mol. Its IUPAC name is 2-pentoxybenzenesulfonyl chloride.
Molecular Properties
| Compound Name | 2-pentoxybenzenesulfonyl chloride |
| PubChem CID | 87516954 |
| Molecular Formula | C11H15ClO3S |
| Molecular Weight | 262.76 g/mol |
| Exact Mass | 262.04 |
| IUPAC Name | 2-pentoxybenzenesulfonyl chloride |
| SMILES | CCCCCOc1ccccc1S(=O)(=O)Cl |
| InChI | InChI=1S/C11H15ClO3S/c1-2-3-6-9-15-10-7-4-5-8-11(10)16(12,13)14/h4-5,7-8H,2-3,6,9H2,1H3 |
| InChIKey | TVSYYPAGUSVHKK-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.76 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-pentoxybenzenesulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pentoxybenzenesulfonyl chloride?
The IUPAC name of 2-pentoxybenzenesulfonyl chloride (CID 87516954) is 2-pentoxybenzenesulfonyl chloride.
What is the SMILES notation for 2-pentoxybenzenesulfonyl chloride?
The canonical SMILES for 2-pentoxybenzenesulfonyl chloride is CCCCCOc1ccccc1S(=O)(=O)Cl.
What is the InChIKey of 2-pentoxybenzenesulfonyl chloride?
The InChIKey is TVSYYPAGUSVHKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15ClO3S/c1-2-3-6-9-15-10-7-4-5-8-11(10)16(12,13)14/h4-5,7-8H,2-3,6,9H2,1H3.
What are the key properties of 2-pentoxybenzenesulfonyl chloride?
2-pentoxybenzenesulfonyl chloride has a molecular weight of 262.76 g/mol, XLogP of 3.18, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pentoxybenzenesulfonyl chloride is sourced from PubChem (CID 87516954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).