About 1-ethylsulfonyl-2-pentoxybenzene;pentane
1-ethylsulfonyl-2-pentoxybenzene;pentane (PubChem CID 174761718) has the molecular formula C18H32O3S
and a molecular weight of 328.52 g/mol. Its IUPAC name is 1-ethylsulfonyl-2-pentoxybenzene;pentane.
Molecular Properties
| Compound Name | 1-ethylsulfonyl-2-pentoxybenzene;pentane |
| PubChem CID | 174761718 |
| Molecular Formula | C18H32O3S |
| Molecular Weight | 328.52 g/mol |
| Exact Mass | 328.21 |
| IUPAC Name | 1-ethylsulfonyl-2-pentoxybenzene;pentane |
| SMILES | CCCCC.CCCCCOc1ccccc1S(=O)(=O)CC |
| InChI | InChI=1S/C13H20O3S.C5H12/c1-3-5-8-11-16-12-9-6-7-10-13(12)17(14,15)4-2;1-3-5-4-2/h6-7,9-10H,3-5,8,11H2,1-2H3;3-5H2,1-2H3 |
| InChIKey | NYYAUKVZHLTZEJ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 328.52 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-ethylsulfonyl-2-pentoxybenzene;pentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethylsulfonyl-2-pentoxybenzene;pentane?
The IUPAC name of 1-ethylsulfonyl-2-pentoxybenzene;pentane (CID 174761718) is 1-ethylsulfonyl-2-pentoxybenzene;pentane.
What is the SMILES notation for 1-ethylsulfonyl-2-pentoxybenzene;pentane?
The canonical SMILES for 1-ethylsulfonyl-2-pentoxybenzene;pentane is CCCCC.CCCCCOc1ccccc1S(=O)(=O)CC.
What is the InChIKey of 1-ethylsulfonyl-2-pentoxybenzene;pentane?
The InChIKey is NYYAUKVZHLTZEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O3S.C5H12/c1-3-5-8-11-16-12-9-6-7-10-13(12)17(14,15)4-2;1-3-5-4-2/h6-7,9-10H,3-5,8,11H2,1-2H3;3-5H2,1-2H3.
What are the key properties of 1-ethylsulfonyl-2-pentoxybenzene;pentane?
1-ethylsulfonyl-2-pentoxybenzene;pentane has a molecular weight of 328.52 g/mol, XLogP of 5.25, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethylsulfonyl-2-pentoxybenzene;pentane is sourced from PubChem (CID 174761718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).