About 1-ethyl-2-heptoxybenzene
1-ethyl-2-heptoxybenzene (PubChem CID 22723794) has the molecular formula C15H24O
and a molecular weight of 220.36 g/mol. Its IUPAC name is 1-ethyl-2-heptoxybenzene.
Molecular Properties
| Compound Name | 1-ethyl-2-heptoxybenzene |
| PubChem CID | 22723794 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | 1-ethyl-2-heptoxybenzene |
| SMILES | CCCCCCCOc1ccccc1CC |
| InChI | InChI=1S/C15H24O/c1-3-5-6-7-10-13-16-15-12-9-8-11-14(15)4-2/h8-9,11-12H,3-7,10,13H2,1-2H3 |
| InChIKey | HLGGBSNOEGBZON-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-2-heptoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-2-heptoxybenzene?
The IUPAC name of 1-ethyl-2-heptoxybenzene (CID 22723794) is 1-ethyl-2-heptoxybenzene.
What is the SMILES notation for 1-ethyl-2-heptoxybenzene?
The canonical SMILES for 1-ethyl-2-heptoxybenzene is CCCCCCCOc1ccccc1CC.
What is the InChIKey of 1-ethyl-2-heptoxybenzene?
The InChIKey is HLGGBSNOEGBZON-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O/c1-3-5-6-7-10-13-16-15-12-9-8-11-14(15)4-2/h8-9,11-12H,3-7,10,13H2,1-2H3.
What are the key properties of 1-ethyl-2-heptoxybenzene?
1-ethyl-2-heptoxybenzene has a molecular weight of 220.36 g/mol, XLogP of 4.60, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-2-heptoxybenzene is sourced from PubChem (CID 22723794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).