About 1-butyl-2-nonoxybenzene
1-butyl-2-nonoxybenzene (PubChem CID 118255282) has the molecular formula C19H32O
and a molecular weight of 276.46 g/mol. Its IUPAC name is 1-butyl-2-nonoxybenzene.
Molecular Properties
| Compound Name | 1-butyl-2-nonoxybenzene |
| PubChem CID | 118255282 |
| Molecular Formula | C19H32O |
| Molecular Weight | 276.46 g/mol |
| Exact Mass | 276.25 |
| IUPAC Name | 1-butyl-2-nonoxybenzene |
| SMILES | CCCCCCCCCOc1ccccc1CCCC |
| InChI | InChI=1S/C19H32O/c1-3-5-7-8-9-10-13-17-20-19-16-12-11-15-18(19)14-6-4-2/h11-12,15-16H,3-10,13-14,17H2,1-2H3 |
| InChIKey | BIWACSGPFBWNHY-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 276.46 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-2-nonoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-2-nonoxybenzene?
The IUPAC name of 1-butyl-2-nonoxybenzene (CID 118255282) is 1-butyl-2-nonoxybenzene.
What is the SMILES notation for 1-butyl-2-nonoxybenzene?
The canonical SMILES for 1-butyl-2-nonoxybenzene is CCCCCCCCCOc1ccccc1CCCC.
What is the InChIKey of 1-butyl-2-nonoxybenzene?
The InChIKey is BIWACSGPFBWNHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H32O/c1-3-5-7-8-9-10-13-17-20-19-16-12-11-15-18(19)14-6-4-2/h11-12,15-16H,3-10,13-14,17H2,1-2H3.
What are the key properties of 1-butyl-2-nonoxybenzene?
1-butyl-2-nonoxybenzene has a molecular weight of 276.46 g/mol, XLogP of 6.16, 12 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-2-nonoxybenzene is sourced from PubChem (CID 118255282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).