About (2-octoxyphenyl)methanol
(2-octoxyphenyl)methanol (PubChem CID 43128604) has the molecular formula C15H24O2
and a molecular weight of 236.35 g/mol. Its IUPAC name is (2-octoxyphenyl)methanol.
Molecular Properties
| Compound Name | (2-octoxyphenyl)methanol |
| PubChem CID | 43128604 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | (2-octoxyphenyl)methanol |
| SMILES | CCCCCCCCOc1ccccc1CO |
| InChI | InChI=1S/C15H24O2/c1-2-3-4-5-6-9-12-17-15-11-8-7-10-14(15)13-16/h7-8,10-11,16H,2-6,9,12-13H2,1H3 |
| InChIKey | JUVHZEQFETXTIN-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2-octoxyphenyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-octoxyphenyl)methanol?
The IUPAC name of (2-octoxyphenyl)methanol (CID 43128604) is (2-octoxyphenyl)methanol.
What is the SMILES notation for (2-octoxyphenyl)methanol?
The canonical SMILES for (2-octoxyphenyl)methanol is CCCCCCCCOc1ccccc1CO.
What is the InChIKey of (2-octoxyphenyl)methanol?
The InChIKey is JUVHZEQFETXTIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O2/c1-2-3-4-5-6-9-12-17-15-11-8-7-10-14(15)13-16/h7-8,10-11,16H,2-6,9,12-13H2,1H3.
What are the key properties of (2-octoxyphenyl)methanol?
(2-octoxyphenyl)methanol has a molecular weight of 236.35 g/mol, XLogP of 3.92, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-octoxyphenyl)methanol is sourced from PubChem (CID 43128604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).