C40H50O8S2 — CID 139826939
1-(2,2-dimethylpropoxy)-2-[4-[6-[4-[2-(2,2-dimethylpropoxy)phenyl]sulfonylphenoxy]hexoxy]phenyl]sulfonylbenzene (PubChem CID 139826939) has the molecular formula C40H50O8S2 and a molecular weight of 722.97 g/mol. Its IUPAC name is 1-(2,2-dimethylpropoxy)-2-[4-[6-[4-[2-(2,2-dimethylpropoxy)phenyl]sulfonylphenoxy]hexoxy]phenyl]sulfonylbenzene.
| Compound Name | 1-(2,2-dimethylpropoxy)-2-[4-[6-[4-[2-(2,2-dimethylpropoxy)phenyl]sulfonylphenoxy]hexoxy]phenyl]sulfonylbenzene |
|---|---|
| PubChem CID | 139826939 |
| Molecular Formula | C40H50O8S2 |
| Molecular Weight | 722.97 g/mol |
| Exact Mass | 722.29 |
| IUPAC Name | 1-(2,2-dimethylpropoxy)-2-[4-[6-[4-[2-(2,2-dimethylpropoxy)phenyl]sulfonylphenoxy]hexoxy]phenyl]sulfonylbenzene |
| SMILES | CC(C)(C)COc1ccccc1S(=O)(=O)c1ccc(OCCCCCCOc2ccc(S(=O)(=O)c3ccccc3OCC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C40H50O8S2/c1-39(2,3)29-47-35-15-9-11-17-37(35)49(41,42)33-23-19-31(20-24-33)45-27-13-7-8-14-28-46-32-21-25-34(26-22-32)50(43,44)38-18-12-10-16-36(38)48-30-40(4,5)6/h9-12,15-26H,7-8,13-14,27-30H2,1-6H3 |
| InChIKey | BRZAFNVMVMZFFD-UHFFFAOYSA-N |
| XLogP | 9.22 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.97 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|