C33H36O8S2 — CID 139963527
4-[4-[7-[4-(4-ethoxyphenyl)sulfonylphenoxy]heptoxy]phenyl]sulfonylphenol (PubChem CID 139963527) has the molecular formula C33H36O8S2 and a molecular weight of 624.78 g/mol. Its IUPAC name is 4-[4-[7-[4-(4-ethoxyphenyl)sulfonylphenoxy]heptoxy]phenyl]sulfonylphenol.
| Compound Name | 4-[4-[7-[4-(4-ethoxyphenyl)sulfonylphenoxy]heptoxy]phenyl]sulfonylphenol |
|---|---|
| PubChem CID | 139963527 |
| Molecular Formula | C33H36O8S2 |
| Molecular Weight | 624.78 g/mol |
| Exact Mass | 624.19 |
| IUPAC Name | 4-[4-[7-[4-(4-ethoxyphenyl)sulfonylphenoxy]heptoxy]phenyl]sulfonylphenol |
| SMILES | CCOc1ccc(S(=O)(=O)c2ccc(OCCCCCCCOc3ccc(S(=O)(=O)c4ccc(O)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C33H36O8S2/c1-2-39-27-10-18-31(19-11-27)43(37,38)33-22-14-29(15-23-33)41-25-7-5-3-4-6-24-40-28-12-20-32(21-13-28)42(35,36)30-16-8-26(34)9-17-30/h8-23,34H,2-7,24-25H2,1H3 |
| InChIKey | RZEFOEDIOLNJFN-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.78 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|