C28H26O9S2 — CID 22020843
4-[4-[2-[2-[4-(4-hydroxyphenyl)sulfonylphenoxy]ethoxy]ethoxy]phenyl]sulfonylphenol (PubChem CID 22020843) has the molecular formula C28H26O9S2 and a molecular weight of 570.64 g/mol. Its IUPAC name is 4-[4-[2-[2-[4-(4-hydroxyphenyl)sulfonylphenoxy]ethoxy]ethoxy]phenyl]sulfonylphenol.
| Compound Name | 4-[4-[2-[2-[4-(4-hydroxyphenyl)sulfonylphenoxy]ethoxy]ethoxy]phenyl]sulfonylphenol |
|---|---|
| PubChem CID | 22020843 |
| Molecular Formula | C28H26O9S2 |
| Molecular Weight | 570.64 g/mol |
| Exact Mass | 570.10 |
| IUPAC Name | 4-[4-[2-[2-[4-(4-hydroxyphenyl)sulfonylphenoxy]ethoxy]ethoxy]phenyl]sulfonylphenol |
| SMILES | O=S(=O)(c1ccc(O)cc1)c1ccc(OCCOCCOc2ccc(S(=O)(=O)c3ccc(O)cc3)cc2)cc1 |
| InChI | InChI=1S/C28H26O9S2/c29-21-1-9-25(10-2-21)38(31,32)27-13-5-23(6-14-27)36-19-17-35-18-20-37-24-7-15-28(16-8-24)39(33,34)26-11-3-22(30)4-12-26/h1-16,29-30H,17-20H2 |
| InChIKey | HHAXYGLOHALPAZ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.64 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|