C10H14O6S — CID 21471088
4-[2-(2-hydroxyethoxy)ethoxy]benzenesulfonic acid (PubChem CID 21471088) has the molecular formula C10H14O6S and a molecular weight of 262.28 g/mol. Its IUPAC name is 4-[2-(2-hydroxyethoxy)ethoxy]benzenesulfonic acid.
| Compound Name | 4-[2-(2-hydroxyethoxy)ethoxy]benzenesulfonic acid |
|---|---|
| PubChem CID | 21471088 |
| Molecular Formula | C10H14O6S |
| Molecular Weight | 262.28 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | 4-[2-(2-hydroxyethoxy)ethoxy]benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(OCCOCCO)cc1 |
| InChI | InChI=1S/C10H14O6S/c11-5-6-15-7-8-16-9-1-3-10(4-2-9)17(12,13)14/h1-4,11H,5-8H2,(H,12,13,14) |
| InChIKey | ZZBFMGVBDXKZAZ-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.28 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|