C15H24O7S — CID 139432783
4-[3-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]propyl]benzenesulfonic acid (PubChem CID 139432783) has the molecular formula C15H24O7S and a molecular weight of 348.42 g/mol. Its IUPAC name is 4-[3-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]propyl]benzenesulfonic acid.
| Compound Name | 4-[3-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]propyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 139432783 |
| Molecular Formula | C15H24O7S |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 4-[3-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]propyl]benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(CCCOCCOCCOCCO)cc1 |
| InChI | InChI=1S/C15H24O7S/c16-7-9-21-11-13-22-12-10-20-8-1-2-14-3-5-15(6-4-14)23(17,18)19/h3-6,16H,1-2,7-13H2,(H,17,18,19) |
| InChIKey | BARHCYDELKPQQN-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|