C22H29NO10S — CID 170347794
4-[3-[2-[2-[2-(3-methoxy-4-nitrophenoxy)ethoxy]ethoxy]ethoxy]propyl]benzenesulfonic acid (PubChem CID 170347794) has the molecular formula C22H29NO10S and a molecular weight of 499.54 g/mol. Its IUPAC name is 4-[3-[2-[2-[2-(3-methoxy-4-nitrophenoxy)ethoxy]ethoxy]ethoxy]propyl]benzenesulfonic acid.
| Compound Name | 4-[3-[2-[2-[2-(3-methoxy-4-nitrophenoxy)ethoxy]ethoxy]ethoxy]propyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 170347794 |
| Molecular Formula | C22H29NO10S |
| Molecular Weight | 499.54 g/mol |
| Exact Mass | 499.15 |
| IUPAC Name | 4-[3-[2-[2-[2-(3-methoxy-4-nitrophenoxy)ethoxy]ethoxy]ethoxy]propyl]benzenesulfonic acid |
| SMILES | COc1cc(OCCOCCOCCOCCCc2ccc(S(=O)(=O)O)cc2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H29NO10S/c1-29-22-17-19(6-9-21(22)23(24)25)33-16-15-32-14-13-31-12-11-30-10-2-3-18-4-7-20(8-5-18)34(26,27)28/h4-9,17H,2-3,10-16H2,1H3,(H,26,27,28) |
| InChIKey | PTIYZBCMBJVBJE-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 143.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.54 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|