C20H33NO10 — CID 118410599
2,4-bis[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-1-nitrobenzene (PubChem CID 118410599) has the molecular formula C20H33NO10 and a molecular weight of 447.48 g/mol. Its IUPAC name is 2,4-bis[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-1-nitrobenzene.
| Compound Name | 2,4-bis[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-1-nitrobenzene |
|---|---|
| PubChem CID | 118410599 |
| Molecular Formula | C20H33NO10 |
| Molecular Weight | 447.48 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | 2,4-bis[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-1-nitrobenzene |
| SMILES | COCCOCCOCCOc1ccc([N+](=O)[O-])c(OCCOCCOCCOC)c1 |
| InChI | InChI=1S/C20H33NO10/c1-24-5-7-26-9-11-28-13-15-30-18-3-4-19(21(22)23)20(17-18)31-16-14-29-12-10-27-8-6-25-2/h3-4,17H,5-16H2,1-2H3 |
| InChIKey | UDZBAPRJNMQBIW-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 116.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.48 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|