C21H32ClNO11 — CID 71417509
2,4-bis[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-5-nitrobenzoyl chloride (PubChem CID 71417509) has the molecular formula C21H32ClNO11 and a molecular weight of 509.94 g/mol. Its IUPAC name is 2,4-bis[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-5-nitrobenzoyl chloride.
| Compound Name | 2,4-bis[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-5-nitrobenzoyl chloride |
|---|---|
| PubChem CID | 71417509 |
| Molecular Formula | C21H32ClNO11 |
| Molecular Weight | 509.94 g/mol |
| Exact Mass | 509.17 |
| IUPAC Name | 2,4-bis[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-5-nitrobenzoyl chloride |
| SMILES | COCCOCCOCCOc1cc(OCCOCCOCCOC)c([N+](=O)[O-])cc1C(=O)Cl |
| InChI | InChI=1S/C21H32ClNO11/c1-27-3-5-29-7-9-31-11-13-33-19-16-20(18(23(25)26)15-17(19)21(22)24)34-14-12-32-10-8-30-6-4-28-2/h15-16H,3-14H2,1-2H3 |
| InChIKey | PBYVBVBRWGPKNJ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 134.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.94 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|