C14H16N2O10 — CID 2748936
2-[5-(2-acetyloxyethoxy)-2,4-dinitrophenoxy]ethyl acetate (PubChem CID 2748936) has the molecular formula C14H16N2O10 and a molecular weight of 372.29 g/mol. Its IUPAC name is 2-[5-(2-acetyloxyethoxy)-2,4-dinitrophenoxy]ethyl acetate.
| Compound Name | 2-[5-(2-acetyloxyethoxy)-2,4-dinitrophenoxy]ethyl acetate |
|---|---|
| PubChem CID | 2748936 |
| Molecular Formula | C14H16N2O10 |
| Molecular Weight | 372.29 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | 2-[5-(2-acetyloxyethoxy)-2,4-dinitrophenoxy]ethyl acetate |
| SMILES | CC(=O)OCCOc1cc(OCCOC(C)=O)c([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H16N2O10/c1-9(17)23-3-5-25-13-8-14(26-6-4-24-10(2)18)12(16(21)22)7-11(13)15(19)20/h7-8H,3-6H2,1-2H3 |
| InChIKey | AEQRDOBTXXKIFW-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 157.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.29 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|