C14H16N2O9 — CID 22763386
[2-acetyloxy-4-(2,4-dinitrophenoxy)butyl] acetate (PubChem CID 22763386) has the molecular formula C14H16N2O9 and a molecular weight of 356.29 g/mol. Its IUPAC name is [2-acetyloxy-4-(2,4-dinitrophenoxy)butyl] acetate.
| Compound Name | [2-acetyloxy-4-(2,4-dinitrophenoxy)butyl] acetate |
|---|---|
| PubChem CID | 22763386 |
| Molecular Formula | C14H16N2O9 |
| Molecular Weight | 356.29 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | [2-acetyloxy-4-(2,4-dinitrophenoxy)butyl] acetate |
| SMILES | CC(=O)OCC(CCOc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])OC(C)=O |
| InChI | InChI=1S/C14H16N2O9/c1-9(17)24-8-12(25-10(2)18)5-6-23-14-4-3-11(15(19)20)7-13(14)16(21)22/h3-4,7,12H,5-6,8H2,1-2H3 |
| InChIKey | PFUVUEKFZPVKDD-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 148.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.29 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|