C14H22BrN3O5 — CID 141424674
2-(2,4-dinitrophenoxy)ethyl-triethylazanium bromide (PubChem CID 141424674) has the molecular formula C14H22BrN3O5 and a molecular weight of 392.25 g/mol. Its IUPAC name is 2-(2,4-dinitrophenoxy)ethyl-triethylazanium bromide.
| Compound Name | 2-(2,4-dinitrophenoxy)ethyl-triethylazanium bromide |
|---|---|
| PubChem CID | 141424674 |
| Molecular Formula | C14H22BrN3O5 |
| Molecular Weight | 392.25 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | 2-(2,4-dinitrophenoxy)ethyl-triethylazanium bromide |
| SMILES | CC[N+](CC)(CC)CCOc1ccc([N+](=O)[O-])cc1[N+](=O)[O-].[Br-] |
| InChI | InChI=1S/C14H22N3O5.BrH/c1-4-17(5-2,6-3)9-10-22-14-8-7-12(15(18)19)11-13(14)16(20)21;/h7-8,11H,4-6,9-10H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | VSRIKEWMUUTFIF-UHFFFAOYSA-M |
| XLogP | -0.24 |
| TPSA | 95.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.25 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|